Products 2863602-85-9
CAS 2863602-85-9 is the registry number for Anti-Trypanosoma cruzi agent-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-3-(4-methyl-3-nitrophenoxy)naphthalene-1,4-dione (CAS 2863602-85-9) is a chemical compound with the molecular formula C17H10ClNO5 and a molecular weight of 343.7 g/mol. IUPAC name: 2-chloro-3-(4-methyl-3-nitrophenoxy)naphthalene-1,4-dione. InChIKey: NIMYKKHCWOESLX-UHFFFAOYSA-N.
| Molecular formula | C17H10ClNO5 |
|---|---|
| Molecular weight | 343.7 g/mol |
| IUPAC name | 2-chloro-3-(4-methyl-3-nitrophenoxy)naphthalene-1,4-dione |
| InChIKey | NIMYKKHCWOESLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=C(C(=O)C3=CC=CC=C3C2=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)