CAS 2863657-16-1 appears in our catalog under these names: RdRP-IN-2, 98%, RdRP–IN–2, RdRP-IN-2 99%, RdRP-IN-2, 99%, 99%, RdRP-IN-2, 98.01%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 250mg, 100 mg, 50 mg.
(2S)-2-[(8-cyclohexyloxy-1-oxo-2-phenylpyrido[2,1-b][1,3]benzothiazole-4-carbonyl)amino]-3-phenylpropanoic acid (CAS 2863657-16-1) is a chemical compound with the molecular formula C33H30N2O5S and a molecular weight of 566.7 g/mol. IUPAC name: (2S)-2-[(8-cyclohexyloxy-1-oxo-2-phenylpyrido[2,1-b][1,3]benzothiazole-4-carbonyl)amino]-3-phenylpropanoic acid. InChIKey: BQZJTBOLNKPLGS-MHZLTWQESA-N.
| Molecular formula | C33H30N2O5S |
|---|---|
| Molecular weight | 566.7 g/mol |
| IUPAC name | (2S)-2-[(8-cyclohexyloxy-1-oxo-2-phenylpyrido[2,1-b][1,3]benzothiazole-4-carbonyl)amino]-3-phenylpropanoic acid |
| InChIKey | BQZJTBOLNKPLGS-MHZLTWQESA-N |
| SMILES | C1CCC(CC1)OC2=CC3=C(C=C2)SC4=C(C=C(C(=O)N34)C5=CC=CC=C5)C(=O)N[C@@H](CC6=CC=CC=C6)C(=O)O |
Computed by PubChem (NCBI)