Products 2863678-89-9
CAS 2863678-89-9 is the registry number for Antifungal agent 77. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[5-(3-ethyl-1-methylpyrazol-5-yl)-1,2,4-oxadiazol-3-yl]-N-(4-fluorophenyl)benzamide (CAS 2863678-89-9) is a chemical compound with the molecular formula C21H18FN5O2 and a molecular weight of 391.4 g/mol. IUPAC name: 3-[5-(3-ethyl-1-methylpyrazol-5-yl)-1,2,4-oxadiazol-3-yl]-N-(4-fluorophenyl)benzamide. InChIKey: AVAZQGYRWQFUBV-UHFFFAOYSA-N.
| Molecular formula | C21H18FN5O2 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 3-[5-(3-ethyl-1-methylpyrazol-5-yl)-1,2,4-oxadiazol-3-yl]-N-(4-fluorophenyl)benzamide |
| InChIKey | AVAZQGYRWQFUBV-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=C1)C2=NC(=NO2)C3=CC(=CC=C3)C(=O)NC4=CC=C(C=C4)F)C |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 77, orb1941702