Products 2863693-49-4
CAS 2863693-49-4 is the registry number for (E)-4-Fluorophenethyl 3-(4-chloro-3-hydroxyphenyl)acrylate, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-(4-fluorophenyl)ethyl (E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enoate (CAS 2863693-49-4) is a chemical compound with the molecular formula C17H14ClFO3 and a molecular weight of 320.7 g/mol. IUPAC name: 2-(4-fluorophenyl)ethyl (E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enoate. InChIKey: MIMMCRUVUYPIIB-XBXARRHUSA-N.
| Molecular formula | C17H14ClFO3 |
|---|---|
| Molecular weight | 320.7 g/mol |
| IUPAC name | 2-(4-fluorophenyl)ethyl (E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enoate |
| InChIKey | MIMMCRUVUYPIIB-XBXARRHUSA-N |
| SMILES | C1=CC(=CC=C1CCOC(=O)/C=C/C2=CC(=C(C=C2)Cl)O)F |
Computed by PubChem (NCBI)