CAS 2864326-87-2 is the registry number for (S)-N-((S)-3-Chloro-5,6-dihydroisoquinolin-5-yl)-2-methylpropane-2-sulfinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5S)-3-chloro-5,6-dihydroisoquinolin-5-yl]-2-methylpropane-2-sulfinamide (CAS 2864326-87-2) is a chemical compound with the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. IUPAC name: N-[(5S)-3-chloro-5,6-dihydroisoquinolin-5-yl]-2-methylpropane-2-sulfinamide. InChIKey: ZENUCSHCVGHIRJ-FAQQKDIKSA-N.
| Molecular formula | C13H17ClN2OS |
|---|---|
| Molecular weight | 284.81 g/mol |
| IUPAC name | N-[(5S)-3-chloro-5,6-dihydroisoquinolin-5-yl]-2-methylpropane-2-sulfinamide |
| InChIKey | ZENUCSHCVGHIRJ-FAQQKDIKSA-N |
| SMILES | CC(C)(C)S(=O)N[C@H]1CC=CC2=CN=C(C=C12)Cl |
Computed by PubChem (NCBI)