CAS 2864383-31-1 appears in our catalog under these names: Lithium (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carboxylate 98%, Lithium(2R,3R)-3-cyclopropyl-1-methylaziridine-2-carboxylate, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Lithium (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carboxylate (CAS 2864383-31-1) is a chemical compound with the molecular formula C7H10LiNO2 and a molecular weight of 147.1 g/mol. IUPAC name: lithium (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carboxylate. InChIKey: IAWLXOGIFSZMJV-IQLKFINASA-M.
| Molecular formula | C7H10LiNO2 |
|---|---|
| Molecular weight | 147.1 g/mol |
| IUPAC name | lithium (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carboxylate |
| InChIKey | IAWLXOGIFSZMJV-IQLKFINASA-M |
| SMILES | [Li+].CN1[C@@H]([C@@H]1C(=O)[O-])C2CC2 |
Computed by PubChem (NCBI)