CAS 2864418-70-0 appears in our catalog under these names: 2,4,7-Trichloro-8-fluoro-5-methoxypyrido[4,3-d]pyrimidine, 95%, 2,4,7-Trichloro-8-fluoro-5-methoxypyrido[4,3-d]pyrimidine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 500mg, 1g, 5g, 10g, 25g, 100g.
2,4,7-trichloro-8-fluoro-5-methoxypyrido[4,3-d]pyrimidine (CAS 2864418-70-0) is a chemical compound with the molecular formula C8H3Cl3FN3O and a molecular weight of 282.5 g/mol. IUPAC name: 2,4,7-trichloro-8-fluoro-5-methoxypyrido[4,3-d]pyrimidine. InChIKey: YBOJCDGFEDMCDV-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3FN3O |
|---|---|
| Molecular weight | 282.5 g/mol |
| IUPAC name | 2,4,7-trichloro-8-fluoro-5-methoxypyrido[4,3-d]pyrimidine |
| InChIKey | YBOJCDGFEDMCDV-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C2=C1C(=NC(=N2)Cl)Cl)F)Cl |
Computed by PubChem (NCBI)