Products 2864434-36-4
CAS 2864434-36-4 is the registry number for 3′-(9H-Carbazol-9-yl)-N-phenyl[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-carbazol-9-ylphenyl)-N-phenylaniline (CAS 2864434-36-4) is a chemical compound with the molecular formula C30H22N2 and a molecular weight of 410.5 g/mol. IUPAC name: 4-(3-carbazol-9-ylphenyl)-N-phenylaniline. InChIKey: WAAKZQWHMLZQSW-UHFFFAOYSA-N.
| Molecular formula | C30H22N2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-(3-carbazol-9-ylphenyl)-N-phenylaniline |
| InChIKey | WAAKZQWHMLZQSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC(=CC=C3)N4C5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)