CAS 1210470-43-1 is the registry number for N-(4-(9H-Carbazol-9-yl)phenyl)-[1,1'-biphenyl]-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-carbazol-9-ylphenyl)-4-phenylaniline (CAS 1210470-43-1) is a chemical compound with the molecular formula C30H22N2 and a molecular weight of 410.5 g/mol. IUPAC name: N-(4-carbazol-9-ylphenyl)-4-phenylaniline. InChIKey: RRFNXQBSDBVPJA-UHFFFAOYSA-N.
| Molecular formula | C30H22N2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | N-(4-carbazol-9-ylphenyl)-4-phenylaniline |
| InChIKey | RRFNXQBSDBVPJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)N4C5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)