Products 2866314-76-1
CAS 2866314-76-1 is the registry number for 2-(2-Cyclopropylpyridin-3-yl)-4-fluorophenol, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-cyclopropyl-3-pyridinyl)-4-fluorophenol (CAS 2866314-76-1) is a chemical compound with the molecular formula C14H12FNO and a molecular weight of 229.25 g/mol. IUPAC name: 2-(2-cyclopropyl-3-pyridinyl)-4-fluorophenol. InChIKey: YUVIOJKZKIGMDF-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO |
|---|---|
| Molecular weight | 229.25 g/mol |
| IUPAC name | 2-(2-cyclopropyl-3-pyridinyl)-4-fluorophenol |
| InChIKey | YUVIOJKZKIGMDF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC=N2)C3=C(C=CC(=C3)F)O |
Computed by PubChem (NCBI)