Products 390-80-7

CAS 390-80-7 is the registry number for 2-Acetamino-4'-fluorobiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[2-(4-fluorophenyl)phenyl]acetamide (CAS 390-80-7) is a chemical compound with the molecular formula C14H12FNO and a molecular weight of 229.25 g/mol. IUPAC name: N-[2-(4-fluorophenyl)phenyl]acetamide. InChIKey: QKTVMAFXXBVYJP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12FNO
Molecular weight229.25 g/mol
IUPAC nameN-[2-(4-fluorophenyl)phenyl]acetamide
InChIKeyQKTVMAFXXBVYJP-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=CC=C1C2=CC=C(C=C2)F

Computed by PubChem (NCBI)