CAS 2866332-82-1 is the registry number for 5-(Difluoromethoxy)-2-isopropylpyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(difluoromethoxy)-2-propan-2-ylpyrimidin-4-amine (CAS 2866332-82-1) is a chemical compound with the molecular formula C8H11F2N3O and a molecular weight of 203.19 g/mol. IUPAC name: 5-(difluoromethoxy)-2-propan-2-ylpyrimidin-4-amine. InChIKey: ZVDNKTDVBGXMBH-UHFFFAOYSA-N.
| Molecular formula | C8H11F2N3O |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-(difluoromethoxy)-2-propan-2-ylpyrimidin-4-amine |
| InChIKey | ZVDNKTDVBGXMBH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(C(=N1)N)OC(F)F |
Computed by PubChem (NCBI)