CAS 2867519-51-3 is the registry number for TMX-4140. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one (CAS 2867519-51-3) is a chemical compound with the molecular formula C25H20ClN5O and a molecular weight of 441.9 g/mol. IUPAC name: 1-[5-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one. InChIKey: KNVNHPJZBGYCIW-UHFFFAOYSA-N.
| Molecular formula | C25H20ClN5O |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 1-[5-[[5-chloro-4-(3-phenylphenyl)pyrimidin-2-yl]amino]-3-pyridinyl]pyrrolidin-2-one |
| InChIKey | KNVNHPJZBGYCIW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CN=CC(=C2)NC3=NC=C(C(=N3)C4=CC=CC(=C4)C5=CC=CC=C5)Cl |
Computed by PubChem (NCBI)