CAS 286836-15-5 appears in our catalog under these names: 7-Bromo-5-nitrobenzofuran-2-carboxylic acid, 7-Bromo-5-nitrobenzofuran-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
7-bromo-5-nitro-1-benzofuran-2-carboxylic acid (CAS 286836-15-5) is a chemical compound with the molecular formula C9H4BrNO5 and a molecular weight of 286.04 g/mol. IUPAC name: 7-bromo-5-nitro-1-benzofuran-2-carboxylic acid. InChIKey: DZAZWBGACAWPOT-UHFFFAOYSA-N.
| Molecular formula | C9H4BrNO5 |
|---|---|
| Molecular weight | 286.04 g/mol |
| IUPAC name | 7-bromo-5-nitro-1-benzofuran-2-carboxylic acid |
| InChIKey | DZAZWBGACAWPOT-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(OC2=C(C=C1[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)