CAS 2869099-50-1 is the registry number for Anti-osteoporosis agent-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-benzyl-3,4-bis(phenylselanyl)pyrrole-2,5-dione (CAS 2869099-50-1) is a chemical compound with the molecular formula C23H17NO2Se2 and a molecular weight of 497.3 g/mol. IUPAC name: 1-benzyl-3,4-bis(phenylselanyl)pyrrole-2,5-dione. InChIKey: SKYWWMWKMFOALL-UHFFFAOYSA-N.
| Molecular formula | C23H17NO2Se2 |
|---|---|
| Molecular weight | 497.3 g/mol |
| IUPAC name | 1-benzyl-3,4-bis(phenylselanyl)pyrrole-2,5-dione |
| InChIKey | SKYWWMWKMFOALL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(=C(C2=O)[Se]C3=CC=CC=C3)[Se]C4=CC=CC=C4 |
Computed by PubChem (NCBI)