CAS 286947-68-0 appears in our catalog under these names: 4-Iodophenylsulfur pentafluoride, 95%, 4–Iodophenylsulfur pentafluoride, 4-Iodophenylsulfur Pentafluoride, >94.0%(GC), 4-Iodophenylsulphur pentafluoride 98%, 4-Iodophenylsulfur Pentafluoride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g.
Pentafluoro-(4-iodophenyl)-lambda6-sulfane (CAS 286947-68-0) is a chemical compound with the molecular formula C6H4F5IS and a molecular weight of 330.06 g/mol. IUPAC name: pentafluoro-(4-iodophenyl)-lambda6-sulfane. InChIKey: FRYANWYSCROOCU-UHFFFAOYSA-N.
| Molecular formula | C6H4F5IS |
|---|---|
| Molecular weight | 330.06 g/mol |
| IUPAC name | pentafluoro-(4-iodophenyl)-lambda6-sulfane |
| InChIKey | FRYANWYSCROOCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(F)(F)(F)(F)F)I |
Computed by PubChem (NCBI)