CAS 2869901-98-2 is the registry number for (R)-1-Fluoro-6-methyl-6,7-dihydroimidazo[1,5-a]pyrazin-8(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-1-fluoro-6-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (CAS 2869901-98-2) is a chemical compound with the molecular formula C7H8FN3O and a molecular weight of 169.16 g/mol. IUPAC name: (6R)-1-fluoro-6-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one. InChIKey: SBYKNKNCWHAAIR-SCSAIBSYSA-N.
| Molecular formula | C7H8FN3O |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | (6R)-1-fluoro-6-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| InChIKey | SBYKNKNCWHAAIR-SCSAIBSYSA-N |
| SMILES | C[C@@H]1CN2C=NC(=C2C(=O)N1)F |
Computed by PubChem (NCBI)