CAS 287100-73-6 appears in our catalog under these names: D-Glucitol-2-¹³C, D–Sorbitol–13C, D-Glucitol-2-13C, D-Sorbitol-13C, 98.0%, 98.0%, D-Sorbitol-13C, 98.0%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 5mg, 250mg, 1mg, 10 mg, 5 mg, 1 mg.
(2S,3R,4R,5R)-(213C)hexane-1,2,3,4,5,6-hexol (CAS 287100-73-6) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 183.16 g/mol. IUPAC name: (2S,3R,4R,5R)-(213C)hexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-NENHMXJQSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2S,3R,4R,5R)-(213C)hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-NENHMXJQSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([13C@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)