CAS 287111-05-1 is the registry number for Myristic Acid-13C14. Offered by: TRC. Available pack sizes: 5mg.
(1,2,3,4,5,6,7,8,9,10,11,12,13,14-13C14)tetradecanoic acid (CAS 287111-05-1) is a chemical compound with the molecular formula C14H28O2 and a molecular weight of 242.27 g/mol. IUPAC name: (1,2,3,4,5,6,7,8,9,10,11,12,13,14-13C14)tetradecanoic acid. InChIKey: TUNFSRHWOTWDNC-FIJHWJEJSA-N.
| Molecular formula | C14H28O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (1,2,3,4,5,6,7,8,9,10,11,12,13,14-13C14)tetradecanoic acid |
| InChIKey | TUNFSRHWOTWDNC-FIJHWJEJSA-N |
| SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)O |
Computed by PubChem (NCBI)