CAS 287111-28-8 appears in our catalog under these names: α-Linolenic acid-13C18, 98%, α-Linolenic acid-13C18, 99.5%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 1 mg, 10 mg.
(9Z,12Z,15Z)-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-13C18)octadeca-9,12,15-trienoic acid (CAS 287111-28-8) is a chemical compound with the molecular formula C18H30O2 and a molecular weight of 296.30 g/mol. IUPAC name: (9Z,12Z,15Z)-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-13C18)octadeca-9,12,15-trienoic acid. InChIKey: DTOSIQBPPRVQHS-JHNAZIRYSA-N.
| Molecular formula | C18H30O2 |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | (9Z,12Z,15Z)-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18-13C18)octadeca-9,12,15-trienoic acid |
| InChIKey | DTOSIQBPPRVQHS-JHNAZIRYSA-N |
| SMILES | [13CH3][13CH2]/[13CH]=[13CH]\[13CH2]/[13CH]=[13CH]\[13CH2]/[13CH]=[13CH]\[13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)O |
Computed by PubChem (NCBI)