Products 287111-44-8
CAS 287111-44-8 is the registry number for 5(6)-Carboxyfluorescein Diisobutyrate. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 5g, 100 mg, 50 mg, 5 g, 1 g.
Acetic acid;[6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate (CAS 287111-44-8) is a chemical compound with the molecular formula C30H28O9 and a molecular weight of 532.5 g/mol. IUPAC name: acetic acid;[6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate. InChIKey: JNSBURABNGJYNE-UHFFFAOYSA-N.
| Molecular formula | C30H28O9 |
|---|---|
| Molecular weight | 532.5 g/mol |
| IUPAC name | acetic acid;[6'-(2-methylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-methylpropanoate |
| InChIKey | JNSBURABNGJYNE-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C(C)C)C5=CC=CC=C5C(=O)O3.CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5(6)-Carboxyfluorescein Diisobutyrate