Products 28718-91-4
CAS 28718-91-4 appears in our catalog under these names: DAPI dilactate, 2-hydroxy-propanoic acid, 2-[4-(aminoiminomethyl)phenyl]-1H-indole-6-carboximidamide (2:1), DAPI (dilactate), 99.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 100 mg, 50 mg, 25 mg, 10 mg.
2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;2-hydroxypropanoic acid (CAS 28718-91-4) is a chemical compound with the molecular formula C19H21N5O3 and a molecular weight of 367.4 g/mol. IUPAC name: 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;2-hydroxypropanoic acid. InChIKey: LCAUPANIXBMNIA-UHFFFAOYSA-N.
| Molecular formula | C19H21N5O3 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;2-hydroxypropanoic acid |
| InChIKey | LCAUPANIXBMNIA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)O.C1=CC(=CC=C1C2=CC3=C(N2)C=C(C=C3)C(=N)N)C(=N)N |
Computed by PubChem (NCBI)