CAS 2872-54-0 appears in our catalog under these names: 8-Hydroxyquinoline sodium salt, 99%, Sodium quinolin-8-olate, 98+%, Poly((9,9-dioctyl-2,7-fluorenylene)-co-(3,8-phenanthroline)) end capped with dimethylphenyl. Offered by: Lumtec, Chemat Brand. Available pack sizes: 1g, 5g, on request.
CAS 2872-54-0 identifies a chemical compound with the molecular formula C9H7NNaO and a molecular weight of 168.15 g/mol. InChIKey: ZVJDFJRDKIADMB-UHFFFAOYSA-N.
| Molecular formula | C9H7NNaO |
|---|---|
| Molecular weight | 168.15 g/mol |
| InChIKey | ZVJDFJRDKIADMB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)N=CC=C2.[Na] |
Computed by PubChem (NCBI)