Products 2873399-22-3
CAS 2873399-22-3 is the registry number for Tubulin polymerization-IN-2. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
2-amino-4-(3,4-difluorophenyl)-7-methoxy-4H-chromene-3-carbonitrile (CAS 2873399-22-3) is a chemical compound with the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. IUPAC name: 2-amino-4-(3,4-difluorophenyl)-7-methoxy-4H-chromene-3-carbonitrile. InChIKey: HWVPIGBUNBADTM-UHFFFAOYSA-N.
| Molecular formula | C17H12F2N2O2 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 2-amino-4-(3,4-difluorophenyl)-7-methoxy-4H-chromene-3-carbonitrile |
| InChIKey | HWVPIGBUNBADTM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(C(=C(O2)N)C#N)C3=CC(=C(C=C3)F)F |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-2, orb1689228