CAS 28736-42-7 appears in our catalog under these names: 1,4-Difluoroanthraquinone, 95%, 1,4-Difluoroanthraquinone 95%, 1,4-Difluoroanthraquinone, 97%, 97%, 1,4-Difluoroanthraquinone, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 100g.
1,4-difluoroanthracene-9,10-dione (CAS 28736-42-7) is a chemical compound with the molecular formula C14H6F2O2 and a molecular weight of 244.19 g/mol. IUPAC name: 1,4-difluoroanthracene-9,10-dione. InChIKey: DTNCXQHDOJRTCD-UHFFFAOYSA-N.
| Molecular formula | C14H6F2O2 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 1,4-difluoroanthracene-9,10-dione |
| InChIKey | DTNCXQHDOJRTCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)F)F |
Computed by PubChem (NCBI)