CAS 287397-89-1 is the registry number for Diethyl Chlorothiophosphate-d10. Offered by: TRC. Available pack sizes: 10mg, 1mg.
Chloro-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane (CAS 287397-89-1) is a chemical compound with the molecular formula C4H10ClO2PS and a molecular weight of 198.67 g/mol. IUPAC name: chloro-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane. InChIKey: KMJJJTCKNZYTEY-MWUKXHIBSA-N.
| Molecular formula | C4H10ClO2PS |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | chloro-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane |
| InChIKey | KMJJJTCKNZYTEY-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC([2H])([2H])C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)