CAS 287397-90-4 is the registry number for O,O-Diethyl Dithiophosphate-d10. Offered by: TRC. Available pack sizes: 25mg.
Bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanyl-sulfanylidene-lambda5-phosphane (CAS 287397-90-4) is a chemical compound with the molecular formula C4H11O2PS2 and a molecular weight of 196.3 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanyl-sulfanylidene-lambda5-phosphane. InChIKey: IRDLUHRVLVEUHA-MWUKXHIBSA-N.
| Molecular formula | C4H11O2PS2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanyl-sulfanylidene-lambda5-phosphane |
| InChIKey | IRDLUHRVLVEUHA-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC([2H])([2H])C([2H])([2H])[2H])S |
Computed by PubChem (NCBI)