CAS 287399-29-5 appears in our catalog under these names: Acetylsalicylic Acid EP Impurity A-13C6 (Aspirin Impurity A-13C6), 4-Hydroxybenzoic-1,2,3,4,5,6-13C6 Acid, >95% (HPLC), 4-Hydroxybenzoic acid-13C6, 99.9%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 5 mg, 1 mg.
4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 287399-29-5) is a chemical compound with the molecular formula C7H6O3 and a molecular weight of 144.077 g/mol. IUPAC name: 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: FJKROLUGYXJWQN-IDEBNGHGSA-N.
| Molecular formula | C7H6O3 |
|---|---|
| Molecular weight | 144.077 g/mol |
| IUPAC name | 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | FJKROLUGYXJWQN-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1C(=O)O)O |
Computed by PubChem (NCBI)