CAS 2874191-84-9 is the registry number for 4-Bromo-2-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene (CAS 2874191-84-9) is a chemical compound with the molecular formula C10H8BrCl and a molecular weight of 243.53 g/mol. IUPAC name: 4-bromo-2-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene. InChIKey: PWCDUCBHKXNWFX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrCl |
|---|---|
| Molecular weight | 243.53 g/mol |
| IUPAC name | 4-bromo-2-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene |
| InChIKey | PWCDUCBHKXNWFX-UHFFFAOYSA-N |
| SMILES | C1C2C1C3=C(C2)C=C(C=C3Cl)Br |
Computed by PubChem (NCBI)