CAS 2874192-43-3 is the registry number for 7-Bromo-2,4-dichloro-8-fluoro-3-nitroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,4-dichloro-8-fluoro-3-nitroquinoline (CAS 2874192-43-3) is a chemical compound with the molecular formula C9H2BrCl2FN2O2 and a molecular weight of 339.93 g/mol. IUPAC name: 7-bromo-2,4-dichloro-8-fluoro-3-nitroquinoline. InChIKey: BCRDXKAGYSXZSI-UHFFFAOYSA-N.
| Molecular formula | C9H2BrCl2FN2O2 |
|---|---|
| Molecular weight | 339.93 g/mol |
| IUPAC name | 7-bromo-2,4-dichloro-8-fluoro-3-nitroquinoline |
| InChIKey | BCRDXKAGYSXZSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C(=N2)Cl)[N+](=O)[O-])Cl)F)Br |
Computed by PubChem (NCBI)