CAS 2874193-13-0 is the registry number for 4,7-Dichloro-8-fluoro-2-(methylthio)pyrido[4,3-d]pyrimidin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-amine (CAS 2874193-13-0) is a chemical compound with the molecular formula C8H5Cl2FN4S and a molecular weight of 279.12 g/mol. IUPAC name: 4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-amine. InChIKey: IWTPLHDJQANECL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FN4S |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-amine |
| InChIKey | IWTPLHDJQANECL-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=NC(=C2F)Cl)N)C(=N1)Cl |
Computed by PubChem (NCBI)