CAS 28744-90-3 is the registry number for Synthon-lab sl036640, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(5Z)-5-[(4-iodophenyl)methylidene]imidazolidine-2,4-dione (CAS 28744-90-3) is a chemical compound with the molecular formula C10H7IN2O2 and a molecular weight of 314.08 g/mol. IUPAC name: (5Z)-5-[(4-iodophenyl)methylidene]imidazolidine-2,4-dione. InChIKey: AYKHCDIQJGOBPJ-YVMONPNESA-N.
| Molecular formula | C10H7IN2O2 |
|---|---|
| Molecular weight | 314.08 g/mol |
| IUPAC name | (5Z)-5-[(4-iodophenyl)methylidene]imidazolidine-2,4-dione |
| InChIKey | AYKHCDIQJGOBPJ-YVMONPNESA-N |
| SMILES | C1=CC(=CC=C1/C=C\2/C(=O)NC(=O)N2)I |
Computed by PubChem (NCBI)