CAS 28747-20-8 is the registry number for S-(2-Hydroxyethyl)glutathione. Offered by: TRC. Available pack sizes: 250mg, 25mg.
S-(2-hydroxyethyl)glutathione is a Glu-Cys-Gly tripeptide derivative of glutathione containing a 2-hydroxyethyl substituent on the S of the Cys residue. It is functionally related to a glutathione.
Source: ChEBI
| Molecular formula | C12H21N3O7S |
|---|---|
| Molecular weight | 351.38 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-(2-hydroxyethylsulfanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | UUZCUSQQEJSIHR-YUMQZZPRSA-N |
| SMILES | C(CC(=O)N[C@@H](CSCCO)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)