CAS 28748-67-6 is the registry number for Methyl 2–hydroxy–2–(thiophen–2–yl)–2–(thiophen–3–yl)acetate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate (CAS 28748-67-6) is a chemical compound with the molecular formula C11H10O3S2 and a molecular weight of 254.3 g/mol. IUPAC name: methyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate. InChIKey: HUFFVYBQYVJQPH-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | methyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate |
| InChIKey | HUFFVYBQYVJQPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CSC=C1)(C2=CC=CS2)O |
Computed by PubChem (NCBI)