Products 28748-67-6

CAS 28748-67-6 is the registry number for Methyl 2–hydroxy–2–(thiophen–2–yl)–2–(thiophen–3–yl)acetate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate (CAS 28748-67-6) is a chemical compound with the molecular formula C11H10O3S2 and a molecular weight of 254.3 g/mol. IUPAC name: methyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate. InChIKey: HUFFVYBQYVJQPH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3S2
Molecular weight254.3 g/mol
IUPAC namemethyl 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate
InChIKeyHUFFVYBQYVJQPH-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CSC=C1)(C2=CC=CS2)O

Computed by PubChem (NCBI)