CAS 287484-46-2 appears in our catalog under these names: Biuret-15N3, >95% (HPLC), Biuret-15N3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 25 mg, 10 mg.
(15N)azanylcarbonylurea (CAS 287484-46-2) is a chemical compound with the molecular formula C2H5N3O2 and a molecular weight of 106.06 g/mol. IUPAC name: (15N)azanylcarbonylurea. InChIKey: OHJMTUPIZMNBFR-FRSWOAELSA-N.
| Molecular formula | C2H5N3O2 |
|---|---|
| Molecular weight | 106.06 g/mol |
| IUPAC name | (15N)azanylcarbonylurea |
| InChIKey | OHJMTUPIZMNBFR-FRSWOAELSA-N |
| SMILES | C(=O)([15NH2])[15NH]C(=O)[15NH2] |
Computed by PubChem (NCBI)