CAS 28755-03-5 appears in our catalog under these names: 3CAI, 2-Chloro-1-(1h-indol-3-yl)ethanone, 95%, 3-(Chloroacetyl)indole, 3CAI/ 98.13% (existing batch purity), 3CAI, 98.32%. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, MedChemExpress. Available pack sizes: 5mg, 1g, 5g, 500mg, 10mg, 25mg, 50mg, 100mg.
2-chloro-1-(1H-indol-3-yl)ethanone (CAS 28755-03-5) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 2-chloro-1-(1H-indol-3-yl)ethanone. InChIKey: LLZQFAXTCYDVTR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 2-chloro-1-(1H-indol-3-yl)ethanone |
| InChIKey | LLZQFAXTCYDVTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)CCl |
Computed by PubChem (NCBI)