CAS 2876-21-3 appears in our catalog under these names: 2-Iodophenazine, 95%, 2-Iodophenazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg.
2-iodophenazine (CAS 2876-21-3) is a chemical compound with the molecular formula C12H7IN2 and a molecular weight of 306.10 g/mol. IUPAC name: 2-iodophenazine. InChIKey: FQUDIWVQNWDEPP-UHFFFAOYSA-N.
| Molecular formula | C12H7IN2 |
|---|---|
| Molecular weight | 306.10 g/mol |
| IUPAC name | 2-iodophenazine |
| InChIKey | FQUDIWVQNWDEPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=CC3=N2)I |
Computed by PubChem (NCBI)