CAS 2876145-34-3 is the registry number for 2-(Difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2876145-34-3) is a chemical compound with the molecular formula C14H17BF2N2O2 and a molecular weight of 294.11 g/mol. IUPAC name: 2-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: JHAWPRQVMZJRID-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2N2O2 |
|---|---|
| Molecular weight | 294.11 g/mol |
| IUPAC name | 2-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | JHAWPRQVMZJRID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NN(C=C3C=C2)C(F)F |
Computed by PubChem (NCBI)