CAS 28767-75-1 appears in our catalog under these names: N1-(2,4-Dinitrophenyl)ethane-1,2-diamine, 96%, EDDnp, (2,4-Dinitrophenyl)ethylenediamine, 95%, 95%, N*1*-(2,4-Dinitro-phenyl)-ethane-1,2-diamine, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
N'-(2,4-dinitrophenyl)ethane-1,2-diamine (CAS 28767-75-1) is a chemical compound with the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. IUPAC name: N'-(2,4-dinitrophenyl)ethane-1,2-diamine. InChIKey: AIUKPEQJKQUQKZ-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O4 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | N'-(2,4-dinitrophenyl)ethane-1,2-diamine |
| InChIKey | AIUKPEQJKQUQKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCN |
Computed by PubChem (NCBI)