CAS 2877694-62-5 is the registry number for RWT9996. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-cyano-2-fluorophenyl)-5-phenyl-1H-pyrrole-3-sulfonamide (CAS 2877694-62-5) is a chemical compound with the molecular formula C17H12FN3O2S and a molecular weight of 341.4 g/mol. IUPAC name: N-(4-cyano-2-fluorophenyl)-5-phenyl-1H-pyrrole-3-sulfonamide. InChIKey: CIEHJRVOVGTTOK-UHFFFAOYSA-N.
| Molecular formula | C17H12FN3O2S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | N-(4-cyano-2-fluorophenyl)-5-phenyl-1H-pyrrole-3-sulfonamide |
| InChIKey | CIEHJRVOVGTTOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN2)S(=O)(=O)NC3=C(C=C(C=C3)C#N)F |
Computed by PubChem (NCBI)