CAS 2877707-09-8 is the registry number for 7-Bromo-4-chloro-2-(methylthio)pyrazolo[1,5-a][1,3,5]triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4-chloro-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazine (CAS 2877707-09-8) is a chemical compound with the molecular formula C6H4BrClN4S and a molecular weight of 279.55 g/mol. IUPAC name: 7-bromo-4-chloro-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazine. InChIKey: KBVZWWGHAODZJC-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN4S |
|---|---|
| Molecular weight | 279.55 g/mol |
| IUPAC name | 7-bromo-4-chloro-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazine |
| InChIKey | KBVZWWGHAODZJC-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=CC(=NN2C(=N1)Cl)Br |
Computed by PubChem (NCBI)