CAS 2878500-21-9 is the registry number for tert-Butyl 3-(chlorosulfonyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-chlorosulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2878500-21-9) is a chemical compound with the molecular formula C11H19ClN2O4S and a molecular weight of 310.80 g/mol. IUPAC name: tert-butyl 3-chlorosulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: WRCMLRHBIPHPBU-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O4S |
|---|---|
| Molecular weight | 310.80 g/mol |
| IUPAC name | tert-butyl 3-chlorosulfonyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | WRCMLRHBIPHPBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)