CAS 28788-42-3 appears in our catalog under these names: Decalin-d18 (cis/trans mixture), 98 atom % D, min 98% Chemical Purity, Decahydronaphthalene-D18 (cis/trans) 99 atom % D. Offered by: CDN, Deutero. Available pack sizes: 5g, 1g, 0,7ml, 5ml.
1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecadeuterionaphthalene (CAS 28788-42-3) is a chemical compound with the molecular formula C10H18 and a molecular weight of 156.36 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecadeuterionaphthalene. InChIKey: NNBZCPXTIHJBJL-XRRAJICISA-N.
| Molecular formula | C10H18 |
|---|---|
| Molecular weight | 156.36 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecadeuterionaphthalene |
| InChIKey | NNBZCPXTIHJBJL-XRRAJICISA-N |
| SMILES | [2H]C1(C(C(C2(C(C(C(C(C2(C1([2H])[2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)