CAS 287922-73-0 is the registry number for 4-Bromo-n'-hydroxy-1-methyl-1h-pyrazole-3-carboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-bromo-N'-hydroxy-1-methylpyrazole-3-carboximidamide (CAS 287922-73-0) is a chemical compound with the molecular formula C5H7BrN4O and a molecular weight of 219.04 g/mol. IUPAC name: 4-bromo-N'-hydroxy-1-methylpyrazole-3-carboximidamide. InChIKey: BTHNJNKFWJQYTO-UHFFFAOYSA-N.
| Molecular formula | C5H7BrN4O |
|---|---|
| Molecular weight | 219.04 g/mol |
| IUPAC name | 4-bromo-N'-hydroxy-1-methylpyrazole-3-carboximidamide |
| InChIKey | BTHNJNKFWJQYTO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)/C(=N/O)/N)Br |
Computed by PubChem (NCBI)