CAS 2879230-64-3 is the registry number for Antitumor agent-187. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-[3-[ethyl(methyl)carbamoyl]oxy-4-methoxyphenyl]-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate (CAS 2879230-64-3) is a chemical compound with the molecular formula C24H26N2O7 and a molecular weight of 454.5 g/mol. IUPAC name: [3-[3-[ethyl(methyl)carbamoyl]oxy-4-methoxyphenyl]-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate. InChIKey: OWWWSUSMLLXGOW-UHFFFAOYSA-N.
| Molecular formula | C24H26N2O7 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | [3-[3-[ethyl(methyl)carbamoyl]oxy-4-methoxyphenyl]-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate |
| InChIKey | OWWWSUSMLLXGOW-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)OC1=CC2=C(C=C1)C(=O)C(=CO2)C3=CC(=C(C=C3)OC)OC(=O)N(C)CC |
Computed by PubChem (NCBI)