Products 2879234-14-5
CAS 2879234-14-5 is the registry number for Rel-2-((4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl)pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pyridin-4-amine (CAS 2879234-14-5) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pyridin-4-amine. InChIKey: WSSXKMQNDWVWMC-XCBNKYQSSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pyridin-4-amine |
| InChIKey | WSSXKMQNDWVWMC-XCBNKYQSSA-N |
| SMILES | C[C@@H]1[C@H](OC(O1)(C)C)C2=NC=CC(=C2)N |
Computed by PubChem (NCBI)