CAS 2880-89-9 appears in our catalog under these names: 5-Chlorouridine, 95%, 5-Chlorouridine, >95% (HPLC), 5–Chlorouridine, 5-Chlorouridine, 5-Chlorouridine 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 250mg, 500mg, 0,5g, 2g, 10g.
5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 2880-89-9) is a chemical compound with the molecular formula C9H11ClN2O6 and a molecular weight of 278.64 g/mol. IUPAC name: 5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: LDCUBKKZHSYQTJ-UAKXSSHOSA-N.
| Molecular formula | C9H11ClN2O6 |
|---|---|
| Molecular weight | 278.64 g/mol |
| IUPAC name | 5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | LDCUBKKZHSYQTJ-UAKXSSHOSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)Cl |
Computed by PubChem (NCBI)