CAS 288071-87-4 appears in our catalog under these names: 4,7-Bis(5-bromo-2-thienyl)-2,1,3-benzothiadiazole, 95%, 4,7–Bis(5–bromo–2–thienyl)–2,1,3–benzothiadiazole, 4,7-Bis(5-bromo-2-thienyl)-2,1,3-benzothiadiazole, >95.0%(HPLC)(N), FBT 95% (stabilized with Cu+HQ+MgO), 4,7-BIS(2-BROMO-5-THIENYL)-2,1,3-BENZOT&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 25g.
4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole (CAS 288071-87-4) is a chemical compound with the molecular formula C14H6Br2N2S3 and a molecular weight of 458.2 g/mol. IUPAC name: 4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole. InChIKey: ZIIMIGRZSUYQGW-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2N2S3 |
|---|---|
| Molecular weight | 458.2 g/mol |
| IUPAC name | 4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole |
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NSN=C2C(=C1)C3=CC=C(S3)Br)C4=CC=C(S4)Br |
Computed by PubChem (NCBI)