Products 2881024-09-3
CAS 2881024-09-3 is the registry number for Huanglongmycin N. Offered by: MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg.
2-acetyl-7-ethyl-1,8-dihydroxy-3-methylanthracene-9,10-dione (CAS 2881024-09-3) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 324.3 g/mol. IUPAC name: 2-acetyl-7-ethyl-1,8-dihydroxy-3-methylanthracene-9,10-dione. InChIKey: VYJBLWXOYRRIMU-UHFFFAOYSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-acetyl-7-ethyl-1,8-dihydroxy-3-methylanthracene-9,10-dione |
| InChIKey | VYJBLWXOYRRIMU-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C(=C(C(=C3)C)C(=O)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Huanglongmycin N, orb1744709