CAS 2882170-83-2 is the registry number for tert-Butyl 3-oxo-1-thia-8-azaspiro[4.5]decane-8-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1,1,3-trioxo-1lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate (CAS 2882170-83-2) is a chemical compound with the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. IUPAC name: tert-butyl 1,1,3-trioxo-1lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: FZDYLFTXZZZAAI-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5S |
|---|---|
| Molecular weight | 303.38 g/mol |
| IUPAC name | tert-butyl 1,1,3-trioxo-1lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | FZDYLFTXZZZAAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)CS2(=O)=O |
Computed by PubChem (NCBI)